C19H22O3 — CID 127041221
(1S,5R)-1-(hydroxymethyl)-4-(phenylmethoxymethyl)spiro[4.5]deca-3,9-dien-8-one (PubChem CID 127041221) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (1S,5R)-1-(hydroxymethyl)-4-(phenylmethoxymethyl)spiro[4.5]deca-3,9-dien-8-one.
| Compound Name | (1S,5R)-1-(hydroxymethyl)-4-(phenylmethoxymethyl)spiro[4.5]deca-3,9-dien-8-one |
|---|---|
| PubChem CID | 127041221 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (1S,5R)-1-(hydroxymethyl)-4-(phenylmethoxymethyl)spiro[4.5]deca-3,9-dien-8-one |
| SMILES | O=C1C=C[C@@]2(CC1)C(COCc1ccccc1)=CC[C@@H]2CO |
| InChI | InChI=1S/C19H22O3/c20-12-16-6-7-17(19(16)10-8-18(21)9-11-19)14-22-13-15-4-2-1-3-5-15/h1-5,7-8,10,16,20H,6,9,11-14H2/t16-,19+/m1/s1 |
| InChIKey | BBHBYVMLXQWNLR-APWZRJJASA-N |
| XLogP | 3.05 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|