C18H29ClO8S — CID 127041225
(2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-phenylmethoxyhexane-1,2,3,5-tetrol chloride (PubChem CID 127041225) has the molecular formula C18H29ClO8S and a molecular weight of 440.94 g/mol. Its IUPAC name is (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-phenylmethoxyhexane-1,2,3,5-tetrol chloride.
| Compound Name | (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-phenylmethoxyhexane-1,2,3,5-tetrol chloride |
|---|---|
| PubChem CID | 127041225 |
| Molecular Formula | C18H29ClO8S |
| Molecular Weight | 440.94 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-phenylmethoxyhexane-1,2,3,5-tetrol chloride |
| SMILES | OC[C@@H]1[C@@H](O)[C@H](O)C[S+]1C[C@@H](O)[C@H](OCc1ccccc1)[C@H](O)[C@@H](O)CO.[Cl-] |
| InChI | InChI=1S/C18H29O8S.ClH/c19-6-12(21)17(25)18(26-8-11-4-2-1-3-5-11)14(23)10-27-9-13(22)16(24)15(27)7-20;/h1-5,12-25H,6-10H2;1H/q+1;/p-1/t12-,13+,14+,15+,16-,17+,18-,27?;/m0./s1 |
| InChIKey | ZYPIFMBKOPSORV-DVMJIFFGSA-M |
| XLogP | -5.63 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.94 |
| LogP ≤ 5 | -5.63 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|