C13H27ClO8S — CID 127041226
(2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-ethoxyhexane-1,2,3,5-tetrol chloride (PubChem CID 127041226) has the molecular formula C13H27ClO8S and a molecular weight of 378.87 g/mol. Its IUPAC name is (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-ethoxyhexane-1,2,3,5-tetrol chloride.
| Compound Name | (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-ethoxyhexane-1,2,3,5-tetrol chloride |
|---|---|
| PubChem CID | 127041226 |
| Molecular Formula | C13H27ClO8S |
| Molecular Weight | 378.87 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | (2S,3R,4R,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-ethoxyhexane-1,2,3,5-tetrol chloride |
| SMILES | CCO[C@H]([C@H](O)[C@@H](O)CO)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO.[Cl-] |
| InChI | InChI=1S/C13H27O8S.ClH/c1-2-21-13(12(20)7(16)3-14)9(18)6-22-5-8(17)11(19)10(22)4-15;/h7-20H,2-6H2,1H3;1H/q+1;/p-1/t7-,8+,9+,10+,11-,12+,13-,22?;/m0./s1 |
| InChIKey | HCIWDKJXHUVHHW-JUWDZZTESA-M |
| XLogP | -6.81 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.87 |
| LogP ≤ 5 | -6.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|