C18H15ClN6O2 — CID 127041514
5-(4-chlorophenyl)-2-(6,7-dimethoxyquinazolin-4-yl)-1,2,4-triazol-3-amine (PubChem CID 127041514) has the molecular formula C18H15ClN6O2 and a molecular weight of 382.81 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-2-(6,7-dimethoxyquinazolin-4-yl)-1,2,4-triazol-3-amine.
| Compound Name | 5-(4-chlorophenyl)-2-(6,7-dimethoxyquinazolin-4-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 127041514 |
| Molecular Formula | C18H15ClN6O2 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | 5-(4-chlorophenyl)-2-(6,7-dimethoxyquinazolin-4-yl)-1,2,4-triazol-3-amine |
| SMILES | COc1cc2ncnc(-n3nc(-c4ccc(Cl)cc4)nc3N)c2cc1OC |
| InChI | InChI=1S/C18H15ClN6O2/c1-26-14-7-12-13(8-15(14)27-2)21-9-22-17(12)25-18(20)23-16(24-25)10-3-5-11(19)6-4-10/h3-9H,1-2H3,(H2,20,23,24) |
| InChIKey | BJEWLDSERODQTA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |