C18H31N3 — CID 127041656
(1R,2R,3R,5S)-2,6,6-trimethyl-N-[(5-methyl-2-propan-2-yl-1H-imidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine (PubChem CID 127041656) has the molecular formula C18H31N3 and a molecular weight of 289.47 g/mol. Its IUPAC name is (1R,2R,3R,5S)-2,6,6-trimethyl-N-[(5-methyl-2-propan-2-yl-1H-imidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,3R,5S)-2,6,6-trimethyl-N-[(5-methyl-2-propan-2-yl-1H-imidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 127041656 |
| Molecular Formula | C18H31N3 |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.25 |
| IUPAC Name | (1R,2R,3R,5S)-2,6,6-trimethyl-N-[(5-methyl-2-propan-2-yl-1H-imidazol-4-yl)methyl]bicyclo[3.1.1]heptan-3-amine |
| SMILES | Cc1[nH]c(C(C)C)nc1CN[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C18H31N3/c1-10(2)17-20-12(4)16(21-17)9-19-15-8-13-7-14(11(15)3)18(13,5)6/h10-11,13-15,19H,7-9H2,1-6H3,(H,20,21)/t11-,13+,14-,15-/m1/s1 |
| InChIKey | DNJZILNIODENJI-FAAHXZRKSA-N |
| XLogP | 4.00 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |