C12H16O5 — CID 127041680
(3R,6S,7R,8R)-7,8-dihydroxy-3,9-dimethyl-1-oxaspiro[5.5]undec-9-ene-2,11-dione (PubChem CID 127041680) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (3R,6S,7R,8R)-7,8-dihydroxy-3,9-dimethyl-1-oxaspiro[5.5]undec-9-ene-2,11-dione.
| Compound Name | (3R,6S,7R,8R)-7,8-dihydroxy-3,9-dimethyl-1-oxaspiro[5.5]undec-9-ene-2,11-dione |
|---|---|
| PubChem CID | 127041680 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (3R,6S,7R,8R)-7,8-dihydroxy-3,9-dimethyl-1-oxaspiro[5.5]undec-9-ene-2,11-dione |
| SMILES | CC1=CC(=O)[C@]2(CC[C@@H](C)C(=O)O2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H16O5/c1-6-3-4-12(17-11(6)16)8(13)5-7(2)9(14)10(12)15/h5-6,9-10,14-15H,3-4H2,1-2H3/t6-,9-,10-,12-/m1/s1 |
| InChIKey | MMVVQWHXKIAXOJ-XYHAGOFUSA-N |
| XLogP | -0.05 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |