C24H26O3S — CID 127041811
(1S,5R)-1-(naphthalen-2-ylsulfonylmethyl)-4-propan-2-ylspiro[4.5]deca-3,9-dien-8-one (PubChem CID 127041811) has the molecular formula C24H26O3S and a molecular weight of 394.54 g/mol. Its IUPAC name is (1S,5R)-1-(naphthalen-2-ylsulfonylmethyl)-4-propan-2-ylspiro[4.5]deca-3,9-dien-8-one.
| Compound Name | (1S,5R)-1-(naphthalen-2-ylsulfonylmethyl)-4-propan-2-ylspiro[4.5]deca-3,9-dien-8-one |
|---|---|
| PubChem CID | 127041811 |
| Molecular Formula | C24H26O3S |
| Molecular Weight | 394.54 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (1S,5R)-1-(naphthalen-2-ylsulfonylmethyl)-4-propan-2-ylspiro[4.5]deca-3,9-dien-8-one |
| SMILES | CC(C)C1=CC[C@H](CS(=O)(=O)c2ccc3ccccc3c2)[C@@]12C=CC(=O)CC2 |
| InChI | InChI=1S/C24H26O3S/c1-17(2)23-10-8-20(24(23)13-11-21(25)12-14-24)16-28(26,27)22-9-7-18-5-3-4-6-19(18)15-22/h3-7,9-11,13,15,17,20H,8,12,14,16H2,1-2H3/t20-,24+/m1/s1 |
| InChIKey | PUJMQAPTJYSHAS-YKSBVNFPSA-N |
| XLogP | 5.12 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.54 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|