C31H36N4O — CID 127041812
(1E,4E,6E)-1,7-bis[1-(3-methylbutyl)benzimidazol-2-yl]hepta-1,4,6-trien-3-one (PubChem CID 127041812) has the molecular formula C31H36N4O and a molecular weight of 480.66 g/mol. Its IUPAC name is (1E,4E,6E)-1,7-bis[1-(3-methylbutyl)benzimidazol-2-yl]hepta-1,4,6-trien-3-one.
| Compound Name | (1E,4E,6E)-1,7-bis[1-(3-methylbutyl)benzimidazol-2-yl]hepta-1,4,6-trien-3-one |
|---|---|
| PubChem CID | 127041812 |
| Molecular Formula | C31H36N4O |
| Molecular Weight | 480.66 g/mol |
| Exact Mass | 480.29 |
| IUPAC Name | (1E,4E,6E)-1,7-bis[1-(3-methylbutyl)benzimidazol-2-yl]hepta-1,4,6-trien-3-one |
| SMILES | CC(C)CCn1c(/C=C/C=C/C(=O)/C=C/c2nc3ccccc3n2CCC(C)C)nc2ccccc21 |
| InChI | InChI=1S/C31H36N4O/c1-23(2)19-21-34-28-14-8-6-12-26(28)32-30(34)16-10-5-11-25(36)17-18-31-33-27-13-7-9-15-29(27)35(31)22-20-24(3)4/h5-18,23-24H,19-22H2,1-4H3/b11-5+,16-10+,18-17+ |
| InChIKey | CWJZKNAXESEDHF-LKKCPLPWSA-N |
| XLogP | 7.33 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.66 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|