C14H11ClN2OS — CID 127041829
7-chloro-5-phenyl-1,5-dihydropyrido[2,3-e][1,4]thiazepin-2-one (PubChem CID 127041829) has the molecular formula C14H11ClN2OS and a molecular weight of 290.77 g/mol. Its IUPAC name is 7-chloro-5-phenyl-1,5-dihydropyrido[2,3-e][1,4]thiazepin-2-one.
| Compound Name | 7-chloro-5-phenyl-1,5-dihydropyrido[2,3-e][1,4]thiazepin-2-one |
|---|---|
| PubChem CID | 127041829 |
| Molecular Formula | C14H11ClN2OS |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.03 |
| IUPAC Name | 7-chloro-5-phenyl-1,5-dihydropyrido[2,3-e][1,4]thiazepin-2-one |
| SMILES | O=C1CSC(c2ccccc2)c2cc(Cl)cnc2N1 |
| InChI | InChI=1S/C14H11ClN2OS/c15-10-6-11-13(9-4-2-1-3-5-9)19-8-12(18)17-14(11)16-7-10/h1-7,13H,8H2,(H,16,17,18) |
| InChIKey | QVHGHPPLLNYCID-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |