C14H20O3 — CID 127041837
(1S,4'S,5R,6S)-4'-(hydroxymethyl)-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-one (PubChem CID 127041837) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (1S,4'S,5R,6S)-4'-(hydroxymethyl)-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-one.
| Compound Name | (1S,4'S,5R,6S)-4'-(hydroxymethyl)-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-one |
|---|---|
| PubChem CID | 127041837 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (1S,4'S,5R,6S)-4'-(hydroxymethyl)-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-one |
| SMILES | CC(C)C1=CC[C@H](CO)[C@]12CCC(=O)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C14H20O3/c1-8(2)10-4-3-9(7-15)14(10)6-5-11(16)12-13(14)17-12/h4,8-9,12-13,15H,3,5-7H2,1-2H3/t9-,12-,13-,14-/m1/s1 |
| InChIKey | VBJUFKHLIZEGBO-ICGCDAGXSA-N |
| XLogP | 1.70 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|