C15H24O3 — CID 127041839
(1S,2S,4'S,5R,6S)-4'-(hydroxymethyl)-2-methyl-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-ol (PubChem CID 127041839) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1S,2S,4'S,5R,6S)-4'-(hydroxymethyl)-2-methyl-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-ol.
| Compound Name | (1S,2S,4'S,5R,6S)-4'-(hydroxymethyl)-2-methyl-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-ol |
|---|---|
| PubChem CID | 127041839 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1S,2S,4'S,5R,6S)-4'-(hydroxymethyl)-2-methyl-1'-propan-2-ylspiro[7-oxabicyclo[4.1.0]heptane-5,5'-cyclopentene]-2-ol |
| SMILES | CC(C)C1=CC[C@H](CO)[C@]12CC[C@](C)(O)[C@H]1O[C@H]12 |
| InChI | InChI=1S/C15H24O3/c1-9(2)11-5-4-10(8-16)15(11)7-6-14(3,17)12-13(15)18-12/h5,9-10,12-13,16-17H,4,6-8H2,1-3H3/t10-,12+,13-,14+,15-/m1/s1 |
| InChIKey | FDPAISQLXIASAM-MYBUGEPTSA-N |
| XLogP | 1.88 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|