About 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine
6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine (PubChem CID 127041859) has the molecular formula C19H21ClN4O2
and a molecular weight of 372.86 g/mol. Its IUPAC name is 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 127041859 |
| Molecular Formula | C19H21ClN4O2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine |
| SMILES | COc1ccc(-c2nc3ncc(Cl)c(OCC4CCNCC4)c3[nH]2)cc1 |
| InChI | InChI=1S/C19H21ClN4O2/c1-25-14-4-2-13(3-5-14)18-23-16-17(15(20)10-22-19(16)24-18)26-11-12-6-8-21-9-7-12/h2-5,10,12,21H,6-9,11H2,1H3,(H,22,23,24) |
| InChIKey | UBSGGBCEFHAFLS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 72.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine (CID 127041859) is 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine is COc1ccc(-c2nc3ncc(Cl)c(OCC4CCNCC4)c3[nH]2)cc1.
What is the InChIKey of 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine?
The InChIKey is UBSGGBCEFHAFLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21ClN4O2/c1-25-14-4-2-13(3-5-14)18-23-16-17(15(20)10-22-19(16)24-18)26-11-12-6-8-21-9-7-12/h2-5,10,12,21H,6-9,11H2,1H3,(H,22,23,24).
What are the key properties of 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine?
6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine has a molecular weight of 372.86 g/mol, XLogP of 3.67, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(4-methoxyphenyl)-7-(piperidin-4-ylmethoxy)-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 127041859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).