C22H20N2O10Se2 — CID 127041898
(2S)-2-[[2-[[2-[[(1S)-1,2-dicarboxyethyl]carbamoyl]phenyl]diselanyl]benzoyl]amino]butanedioic acid (PubChem CID 127041898) has the molecular formula C22H20N2O10Se2 and a molecular weight of 630.33 g/mol. Its IUPAC name is (2S)-2-[[2-[[2-[[(1S)-1,2-dicarboxyethyl]carbamoyl]phenyl]diselanyl]benzoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[2-[[2-[[(1S)-1,2-dicarboxyethyl]carbamoyl]phenyl]diselanyl]benzoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 127041898 |
| Molecular Formula | C22H20N2O10Se2 |
| Molecular Weight | 630.33 g/mol |
| Exact Mass | 631.94 |
| IUPAC Name | (2S)-2-[[2-[[2-[[(1S)-1,2-dicarboxyethyl]carbamoyl]phenyl]diselanyl]benzoyl]amino]butanedioic acid |
| SMILES | O=C(O)C[C@H](NC(=O)c1ccccc1[Se][Se]c1ccccc1C(=O)N[C@@H](CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H20N2O10Se2/c25-17(26)9-13(21(31)32)23-19(29)11-5-1-3-7-15(11)35-36-16-8-4-2-6-12(16)20(30)24-14(22(33)34)10-18(27)28/h1-8,13-14H,9-10H2,(H,23,29)(H,24,30)(H,25,26)(H,27,28)(H,31,32)(H,33,34)/t13-,14-/m0/s1 |
| InChIKey | IRGZEKLAKMLKOQ-KBPBESRZSA-N |
| XLogP | -1.72 |
| TPSA | 207.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.33 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|