C20H33N3 — CID 127041949
(1R,2R,3R,5S)-N-[(2-cyclopropyl-4-propyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine (PubChem CID 127041949) has the molecular formula C20H33N3 and a molecular weight of 315.51 g/mol. Its IUPAC name is (1R,2R,3R,5S)-N-[(2-cyclopropyl-4-propyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine.
| Compound Name | (1R,2R,3R,5S)-N-[(2-cyclopropyl-4-propyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
|---|---|
| PubChem CID | 127041949 |
| Molecular Formula | C20H33N3 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.27 |
| IUPAC Name | (1R,2R,3R,5S)-N-[(2-cyclopropyl-4-propyl-1H-imidazol-5-yl)methyl]-2,6,6-trimethylbicyclo[3.1.1]heptan-3-amine |
| SMILES | CCCc1nc(C2CC2)[nH]c1CN[C@@H]1C[C@@H]2C[C@H]([C@H]1C)C2(C)C |
| InChI | InChI=1S/C20H33N3/c1-5-6-16-18(23-19(22-16)13-7-8-13)11-21-17-10-14-9-15(12(17)2)20(14,3)4/h12-15,17,21H,5-11H2,1-4H3,(H,22,23)/t12-,14+,15-,17-/m1/s1 |
| InChIKey | WMVSRWMPZWNXDZ-DUFGSWQCSA-N |
| XLogP | 4.40 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |