C32H31N9OS — CID 127042116
N-[5-[5-[4-[[4-(2-isothiocyanatoethyl)piperazin-1-yl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-4-pyridin-3-ylpyrimidin-2-amine (PubChem CID 127042116) has the molecular formula C32H31N9OS and a molecular weight of 589.73 g/mol. Its IUPAC name is N-[5-[5-[4-[[4-(2-isothiocyanatoethyl)piperazin-1-yl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-4-pyridin-3-ylpyrimidin-2-amine.
| Compound Name | N-[5-[5-[4-[[4-(2-isothiocyanatoethyl)piperazin-1-yl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-4-pyridin-3-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 127042116 |
| Molecular Formula | C32H31N9OS |
| Molecular Weight | 589.73 g/mol |
| Exact Mass | 589.24 |
| IUPAC Name | N-[5-[5-[4-[[4-(2-isothiocyanatoethyl)piperazin-1-yl]methyl]phenyl]-1,3,4-oxadiazol-2-yl]-2-methylphenyl]-4-pyridin-3-ylpyrimidin-2-amine |
| SMILES | Cc1ccc(-c2nnc(-c3ccc(CN4CCN(CCN=C=S)CC4)cc3)o2)cc1Nc1nccc(-c2cccnc2)n1 |
| InChI | InChI=1S/C32H31N9OS/c1-23-4-7-26(19-29(23)37-32-35-12-10-28(36-32)27-3-2-11-33-20-27)31-39-38-30(42-31)25-8-5-24(6-9-25)21-41-17-15-40(16-18-41)14-13-34-22-43/h2-12,19-20H,13-18,21H2,1H3,(H,35,36,37) |
| InChIKey | QUNPDWGTGYKASN-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 108.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.73 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|