About tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate
tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate (PubChem CID 127042136) has the molecular formula C14H20N4O5
and a molecular weight of 324.34 g/mol. Its IUPAC name is tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate |
| PubChem CID | 127042136 |
| Molecular Formula | C14H20N4O5 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)NO)c1ccc(/C(N)=N/O)cc1 |
| InChI | InChI=1S/C14H20N4O5/c1-14(2,3)23-13(20)16-10(12(19)18-22)8-4-6-9(7-5-8)11(15)17-21/h4-7,10,21-22H,1-3H3,(H2,15,17)(H,16,20)(H,18,19) |
| InChIKey | RBYYNKXVWWWJOY-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 146.27 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate?
The IUPAC name of tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate (CID 127042136) is tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate.
What is the SMILES notation for tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate?
The canonical SMILES for tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate is CC(C)(C)OC(=O)NC(C(=O)NO)c1ccc(/C(N)=N/O)cc1.
What is the InChIKey of tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate?
The InChIKey is RBYYNKXVWWWJOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O5/c1-14(2,3)23-13(20)16-10(12(19)18-22)8-4-6-9(7-5-8)11(15)17-21/h4-7,10,21-22H,1-3H3,(H2,15,17)(H,16,20)(H,18,19).
What are the key properties of tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate?
tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate has a molecular weight of 324.34 g/mol, XLogP of 0.85, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[2-(hydroxyamino)-1-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxoethyl]carbamate is sourced from PubChem (CID 127042136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).