C17H28N6O3S — CID 127042544
(2S)-2-acetamido-N-[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide (PubChem CID 127042544) has the molecular formula C17H28N6O3S and a molecular weight of 396.52 g/mol. Its IUPAC name is (2S)-2-acetamido-N-[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-acetamido-N-[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 127042544 |
| Molecular Formula | C17H28N6O3S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | (2S)-2-acetamido-N-[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]-4-methylpentanamide |
| SMILES | CC(=O)N[C@@H](CC(C)C)C(=O)N[C@H](CCCN=C(N)N)C(=O)c1nccs1 |
| InChI | InChI=1S/C17H28N6O3S/c1-10(2)9-13(22-11(3)24)15(26)23-12(5-4-6-21-17(18)19)14(25)16-20-7-8-27-16/h7-8,10,12-13H,4-6,9H2,1-3H3,(H,22,24)(H,23,26)(H4,18,19,21)/t12-,13+/m1/s1 |
| InChIKey | UDQQQBAXCWRZGU-OLZOCXBDSA-N |
| XLogP | 0.41 |
| TPSA | 152.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|