C22H14ClF3N2O — CID 127042565
6-[[4-(trifluoromethyl)phenyl]methyl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one chloride (PubChem CID 127042565) has the molecular formula C22H14ClF3N2O and a molecular weight of 414.81 g/mol. Its IUPAC name is 6-[[4-(trifluoromethyl)phenyl]methyl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one chloride.
| Compound Name | 6-[[4-(trifluoromethyl)phenyl]methyl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one chloride |
|---|---|
| PubChem CID | 127042565 |
| Molecular Formula | C22H14ClF3N2O |
| Molecular Weight | 414.81 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | 6-[[4-(trifluoromethyl)phenyl]methyl]-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-6-ium-2-one chloride |
| SMILES | O=c1ccc2c3c(cc[n+]2Cc2ccc(C(F)(F)F)cc2)c2ccccc2n13.[Cl-] |
| InChI | InChI=1S/C22H14F3N2O.ClH/c23-22(24,25)15-7-5-14(6-8-15)13-26-12-11-17-16-3-1-2-4-18(16)27-20(28)10-9-19(26)21(17)27;/h1-12H,13H2;1H/q+1;/p-1 |
| InChIKey | AJTZRHFCZNXRLT-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.81 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|