C32H40N2O10Se2 — CID 127042578
diethyl (2S)-2-[[2-[[2-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]carbamoyl]phenyl]diselanyl]benzoyl]amino]pentanedioate (PubChem CID 127042578) has the molecular formula C32H40N2O10Se2 and a molecular weight of 770.60 g/mol. Its IUPAC name is diethyl (2S)-2-[[2-[[2-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]carbamoyl]phenyl]diselanyl]benzoyl]amino]pentanedioate.
| Compound Name | diethyl (2S)-2-[[2-[[2-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]carbamoyl]phenyl]diselanyl]benzoyl]amino]pentanedioate |
|---|---|
| PubChem CID | 127042578 |
| Molecular Formula | C32H40N2O10Se2 |
| Molecular Weight | 770.60 g/mol |
| Exact Mass | 772.10 |
| IUPAC Name | diethyl (2S)-2-[[2-[[2-[[(2S)-1,5-diethoxy-1,5-dioxopentan-2-yl]carbamoyl]phenyl]diselanyl]benzoyl]amino]pentanedioate |
| SMILES | CCOC(=O)CC[C@H](NC(=O)c1ccccc1[Se][Se]c1ccccc1C(=O)N[C@@H](CCC(=O)OCC)C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C32H40N2O10Se2/c1-5-41-27(35)19-17-23(31(39)43-7-3)33-29(37)21-13-9-11-15-25(21)45-46-26-16-12-10-14-22(26)30(38)34-24(32(40)44-8-4)18-20-28(36)42-6-2/h9-16,23-24H,5-8,17-20H2,1-4H3,(H,33,37)(H,34,38)/t23-,24-/m0/s1 |
| InChIKey | ZEGUMUROWNCXOW-ZEQRLZLVSA-N |
| XLogP | 0.97 |
| TPSA | 163.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 770.60 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|