C11H15NO4 — CID 127042599
(2S,3S,4R,5R)-2-anilinooxane-3,4,5-triol (PubChem CID 127042599) has the molecular formula C11H15NO4 and a molecular weight of 225.24 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-anilinooxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5R)-2-anilinooxane-3,4,5-triol |
|---|---|
| PubChem CID | 127042599 |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (2S,3S,4R,5R)-2-anilinooxane-3,4,5-triol |
| SMILES | O[C@H]1[C@H](O)[C@@H](Nc2ccccc2)OC[C@H]1O |
| InChI | InChI=1S/C11H15NO4/c13-8-6-16-11(10(15)9(8)14)12-7-4-2-1-3-5-7/h1-5,8-15H,6H2/t8-,9-,10+,11+/m1/s1 |
| InChIKey | KDWDKNMYEVXZLV-ZNSHCXBVSA-N |
| XLogP | -0.46 |
| TPSA | 81.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |