About 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol
1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol (PubChem CID 127042691) has the molecular formula C21H19N3O
and a molecular weight of 329.40 g/mol. Its IUPAC name is 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol.
Molecular Properties
| Compound Name | 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol |
| PubChem CID | 127042691 |
| Molecular Formula | C21H19N3O |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol |
| SMILES | OC1=CC(c2cccnc2)N(c2ccccc2)C(c2cccnc2)C1 |
| InChI | InChI=1S/C21H19N3O/c25-19-12-20(16-6-4-10-22-14-16)24(18-8-2-1-3-9-18)21(13-19)17-7-5-11-23-15-17/h1-12,14-15,20-21,25H,13H2 |
| InChIKey | VJQCZMVRJHYIBI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 49.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol?
The IUPAC name of 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol (CID 127042691) is 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol.
What is the SMILES notation for 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol?
The canonical SMILES for 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol is OC1=CC(c2cccnc2)N(c2ccccc2)C(c2cccnc2)C1.
What is the InChIKey of 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol?
The InChIKey is VJQCZMVRJHYIBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O/c25-19-12-20(16-6-4-10-22-14-16)24(18-8-2-1-3-9-18)21(13-19)17-7-5-11-23-15-17/h1-12,14-15,20-21,25H,13H2.
What are the key properties of 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol?
1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol has a molecular weight of 329.40 g/mol, XLogP of 4.61, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-2,6-dipyridin-3-yl-3,6-dihydro-2H-pyridin-4-ol is sourced from PubChem (CID 127042691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).