C16H26O3 — CID 127042782
[(1S,5R)-8,8-dimethoxy-4-propan-2-ylspiro[4.5]deca-3,9-dien-1-yl]methanol (PubChem CID 127042782) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is [(1S,5R)-8,8-dimethoxy-4-propan-2-ylspiro[4.5]deca-3,9-dien-1-yl]methanol.
| Compound Name | [(1S,5R)-8,8-dimethoxy-4-propan-2-ylspiro[4.5]deca-3,9-dien-1-yl]methanol |
|---|---|
| PubChem CID | 127042782 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | [(1S,5R)-8,8-dimethoxy-4-propan-2-ylspiro[4.5]deca-3,9-dien-1-yl]methanol |
| SMILES | COC1(OC)C=C[C@@]2(CC1)C(C(C)C)=CC[C@@H]2CO |
| InChI | InChI=1S/C16H26O3/c1-12(2)14-6-5-13(11-17)15(14)7-9-16(18-3,19-4)10-8-15/h6-7,9,12-13,17H,5,8,10-11H2,1-4H3/t13-,15+/m1/s1 |
| InChIKey | ZMHSZYIVEIXWKY-HIFRSBDPSA-N |
| XLogP | 2.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|