C19H10N2O2 — CID 127042966
2,12-diazapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),3,5,7,9,11,14,16,18-nonaene-20,21-dione (PubChem CID 127042966) has the molecular formula C19H10N2O2 and a molecular weight of 298.30 g/mol. Its IUPAC name is 2,12-diazapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),3,5,7,9,11,14,16,18-nonaene-20,21-dione.
| Compound Name | 2,12-diazapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),3,5,7,9,11,14,16,18-nonaene-20,21-dione |
|---|---|
| PubChem CID | 127042966 |
| Molecular Formula | C19H10N2O2 |
| Molecular Weight | 298.30 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 2,12-diazapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),3,5,7,9,11,14,16,18-nonaene-20,21-dione |
| SMILES | O=C1C(=O)c2c(nc3ccc4ccccc4n23)-c2ccccc21 |
| InChI | InChI=1S/C19H10N2O2/c22-18-13-7-3-2-6-12(13)16-17(19(18)23)21-14-8-4-1-5-11(14)9-10-15(21)20-16/h1-10H |
| InChIKey | BJPBQFSTOVAFAM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.30 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|