C15H16N8O — CID 127043005
2-phenyl-1-[4-([1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-yl)piperazin-1-yl]ethanone (PubChem CID 127043005) has the molecular formula C15H16N8O and a molecular weight of 324.35 g/mol. Its IUPAC name is 2-phenyl-1-[4-([1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-phenyl-1-[4-([1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 127043005 |
| Molecular Formula | C15H16N8O |
| Molecular Weight | 324.35 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 2-phenyl-1-[4-([1,2,4]triazolo[4,3-b][1,2,4,5]tetrazin-6-yl)piperazin-1-yl]ethanone |
| SMILES | O=C(Cc1ccccc1)N1CCN(c2nnc3nncn3n2)CC1 |
| InChI | InChI=1S/C15H16N8O/c24-13(10-12-4-2-1-3-5-12)21-6-8-22(9-7-21)15-19-18-14-17-16-11-23(14)20-15/h1-5,11H,6-10H2 |
| InChIKey | LUGQPSOEQOALRY-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 92.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.35 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |