C18H20O4 — CID 127043086
3,5-dihydroxy-4,6,6-trimethyl-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one (PubChem CID 127043086) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 3,5-dihydroxy-4,6,6-trimethyl-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-4,6,6-trimethyl-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 127043086 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3,5-dihydroxy-4,6,6-trimethyl-2-(3-phenylpropanoyl)cyclohexa-2,4-dien-1-one |
| SMILES | CC1=C(O)C(C)(C)C(=O)C(C(=O)CCc2ccccc2)=C1O |
| InChI | InChI=1S/C18H20O4/c1-11-15(20)14(17(22)18(2,3)16(11)21)13(19)10-9-12-7-5-4-6-8-12/h4-8,20-21H,9-10H2,1-3H3 |
| InChIKey | XJPOYIMDQXGWDV-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|