C31H43N7O7 — CID 127043114
methyl (9S,12S,15S)-12-(cyclohexylmethyl)-6,11,14-trioxo-15-(phenylmethoxycarbonylamino)-1,5,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-9-carboxylate (PubChem CID 127043114) has the molecular formula C31H43N7O7 and a molecular weight of 625.73 g/mol. Its IUPAC name is methyl (9S,12S,15S)-12-(cyclohexylmethyl)-6,11,14-trioxo-15-(phenylmethoxycarbonylamino)-1,5,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-9-carboxylate.
| Compound Name | methyl (9S,12S,15S)-12-(cyclohexylmethyl)-6,11,14-trioxo-15-(phenylmethoxycarbonylamino)-1,5,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-9-carboxylate |
|---|---|
| PubChem CID | 127043114 |
| Molecular Formula | C31H43N7O7 |
| Molecular Weight | 625.73 g/mol |
| Exact Mass | 625.32 |
| IUPAC Name | methyl (9S,12S,15S)-12-(cyclohexylmethyl)-6,11,14-trioxo-15-(phenylmethoxycarbonylamino)-1,5,10,13,18,19-hexazabicyclo[15.2.1]icosa-17(20),18-diene-9-carboxylate |
| SMILES | COC(=O)[C@@H]1CCC(=O)NCCCn2cc(nn2)C[C@H](NC(=O)OCc2ccccc2)C(=O)N[C@@H](CC2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C31H43N7O7/c1-44-30(42)24-13-14-27(39)32-15-8-16-38-19-23(36-37-38)18-26(35-31(43)45-20-22-11-6-3-7-12-22)29(41)34-25(28(40)33-24)17-21-9-4-2-5-10-21/h3,6-7,11-12,19,21,24-26H,2,4-5,8-10,13-18,20H2,1H3,(H,32,39)(H,33,40)(H,34,41)(H,35,43)/t24-,25-,26-/m0/s1 |
| InChIKey | RTNNFOLLNSBDPZ-GSDHBNRESA-N |
| XLogP | 1.53 |
| TPSA | 182.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.73 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |