About N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline
N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline (PubChem CID 127043193) has the molecular formula C16H15ClF3N
and a molecular weight of 313.75 g/mol. Its IUPAC name is N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline |
| PubChem CID | 127043193 |
| Molecular Formula | C16H15ClF3N |
| Molecular Weight | 313.75 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(Nc2cc(Cl)cc(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C16H15ClF3N/c1-9-4-10(2)15(11(3)5-9)21-14-7-12(16(18,19)20)6-13(17)8-14/h4-8,21H,1-3H3 |
| InChIKey | HZQKLNQYONPNKI-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.75 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline?
The IUPAC name of N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline (CID 127043193) is N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline.
What is the SMILES notation for N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline?
The canonical SMILES for N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline is Cc1cc(C)c(Nc2cc(Cl)cc(C(F)(F)F)c2)c(C)c1.
What is the InChIKey of N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline?
The InChIKey is HZQKLNQYONPNKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15ClF3N/c1-9-4-10(2)15(11(3)5-9)21-14-7-12(16(18,19)20)6-13(17)8-14/h4-8,21H,1-3H3.
What are the key properties of N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline?
N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline has a molecular weight of 313.75 g/mol, XLogP of 6.03, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-5-(trifluoromethyl)phenyl]-2,4,6-trimethylaniline is sourced from PubChem (CID 127043193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).