C15H28O4 — CID 127043555
(2S)-2-[(2S,3S,5R)-3,5-diethyl-5-pentyloxolan-2-yl]-2-hydroxyacetic acid (PubChem CID 127043555) has the molecular formula C15H28O4 and a molecular weight of 272.38 g/mol. Its IUPAC name is (2S)-2-[(2S,3S,5R)-3,5-diethyl-5-pentyloxolan-2-yl]-2-hydroxyacetic acid.
| Compound Name | (2S)-2-[(2S,3S,5R)-3,5-diethyl-5-pentyloxolan-2-yl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 127043555 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | (2S)-2-[(2S,3S,5R)-3,5-diethyl-5-pentyloxolan-2-yl]-2-hydroxyacetic acid |
| SMILES | CCCCC[C@]1(CC)C[C@H](CC)[C@@H]([C@H](O)C(=O)O)O1 |
| InChI | InChI=1S/C15H28O4/c1-4-7-8-9-15(6-3)10-11(5-2)13(19-15)12(16)14(17)18/h11-13,16H,4-10H2,1-3H3,(H,17,18)/t11-,12-,13-,15+/m0/s1 |
| InChIKey | AMFPUNUKBPDKTB-PWNZVWSESA-N |
| XLogP | 2.98 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|