About 3-hydroxy-1,4-diphenylbutan-2-one
3-hydroxy-1,4-diphenylbutan-2-one (PubChem CID 12704363) has the molecular formula C16H16O2
and a molecular weight of 240.30 g/mol. Its IUPAC name is 3-hydroxy-1,4-diphenylbutan-2-one.
Molecular Properties
| Compound Name | 3-hydroxy-1,4-diphenylbutan-2-one |
| PubChem CID | 12704363 |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 3-hydroxy-1,4-diphenylbutan-2-one |
| SMILES | O=C(Cc1ccccc1)C(O)Cc1ccccc1 |
| InChI | InChI=1S/C16H16O2/c17-15(11-13-7-3-1-4-8-13)16(18)12-14-9-5-2-6-10-14/h1-10,15,17H,11-12H2 |
| InChIKey | MOLCLXHQJKJETK-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-1,4-diphenylbutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-1,4-diphenylbutan-2-one?
The IUPAC name of 3-hydroxy-1,4-diphenylbutan-2-one (CID 12704363) is 3-hydroxy-1,4-diphenylbutan-2-one.
What is the SMILES notation for 3-hydroxy-1,4-diphenylbutan-2-one?
The canonical SMILES for 3-hydroxy-1,4-diphenylbutan-2-one is O=C(Cc1ccccc1)C(O)Cc1ccccc1.
What is the InChIKey of 3-hydroxy-1,4-diphenylbutan-2-one?
The InChIKey is MOLCLXHQJKJETK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O2/c17-15(11-13-7-3-1-4-8-13)16(18)12-14-9-5-2-6-10-14/h1-10,15,17H,11-12H2.
What are the key properties of 3-hydroxy-1,4-diphenylbutan-2-one?
3-hydroxy-1,4-diphenylbutan-2-one has a molecular weight of 240.30 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-1,4-diphenylbutan-2-one is sourced from PubChem (CID 12704363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).