About (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one
(4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one (PubChem CID 127043643) has the molecular formula C26H18N2O2
and a molecular weight of 390.44 g/mol. Its IUPAC name is (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one.
Molecular Properties
| Compound Name | (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one |
| PubChem CID | 127043643 |
| Molecular Formula | C26H18N2O2 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one |
| SMILES | O=C1/C(=C\c2ccc(-c3ccccc3)o2)C(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C26H18N2O2/c29-26-23(18-22-16-17-24(30-22)19-10-4-1-5-11-19)25(20-12-6-2-7-13-20)27-28(26)21-14-8-3-9-15-21/h1-18H/b23-18- |
| InChIKey | QPKMQJHQRSKMGY-NKFKGCMQSA-N |
| XLogP | 5.78 |
| TPSA | 45.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one?
The IUPAC name of (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one (CID 127043643) is (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one.
What is the SMILES notation for (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one?
The canonical SMILES for (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one is O=C1/C(=C\c2ccc(-c3ccccc3)o2)C(c2ccccc2)=NN1c1ccccc1.
What is the InChIKey of (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one?
The InChIKey is QPKMQJHQRSKMGY-NKFKGCMQSA-N. The full InChI is InChI=1S/C26H18N2O2/c29-26-23(18-22-16-17-24(30-22)19-10-4-1-5-11-19)25(20-12-6-2-7-13-20)27-28(26)21-14-8-3-9-15-21/h1-18H/b23-18-.
What are the key properties of (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one?
(4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one has a molecular weight of 390.44 g/mol, XLogP of 5.78, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-2,5-diphenyl-4-[(5-phenylfuran-2-yl)methylidene]pyrazol-3-one is sourced from PubChem (CID 127043643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).