C34H42O6 — CID 127043739
(2R,13R,15S)-6,8-dihydroxy-17,17-dimethyl-5,15-bis(3-methylbut-2-enyl)-7-[(E)-4-methylpent-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione (PubChem CID 127043739) has the molecular formula C34H42O6 and a molecular weight of 546.70 g/mol. Its IUPAC name is (2R,13R,15S)-6,8-dihydroxy-17,17-dimethyl-5,15-bis(3-methylbut-2-enyl)-7-[(E)-4-methylpent-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione.
| Compound Name | (2R,13R,15S)-6,8-dihydroxy-17,17-dimethyl-5,15-bis(3-methylbut-2-enyl)-7-[(E)-4-methylpent-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
|---|---|
| PubChem CID | 127043739 |
| Molecular Formula | C34H42O6 |
| Molecular Weight | 546.70 g/mol |
| Exact Mass | 546.30 |
| IUPAC Name | (2R,13R,15S)-6,8-dihydroxy-17,17-dimethyl-5,15-bis(3-methylbut-2-enyl)-7-[(E)-4-methylpent-2-enyl]-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraene-10,14-dione |
| SMILES | CC(C)=CCc1c(O)c(C/C=C/C(C)C)c(O)c2c1O[C@@]13C(=C[C@H]4CC1C(C)(C)O[C@]3(CC=C(C)C)C4=O)C2=O |
| InChI | InChI=1S/C34H42O6/c1-18(2)10-9-11-22-27(35)23(13-12-19(3)4)30-26(28(22)36)29(37)24-16-21-17-25-32(7,8)40-33(31(21)38,15-14-20(5)6)34(24,25)39-30/h9-10,12,14,16,18,21,25,35-36H,11,13,15,17H2,1-8H3/b10-9+/t21-,25?,33+,34-/m0/s1 |
| InChIKey | PYXXGWNBZKUTCM-YNDPSWSTSA-N |
| XLogP | 6.72 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.70 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|