About 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione
2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione (PubChem CID 127043741) has the molecular formula C26H24N2O2S
and a molecular weight of 428.56 g/mol. Its IUPAC name is 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione.
Molecular Properties
| Compound Name | 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione |
| PubChem CID | 127043741 |
| Molecular Formula | C26H24N2O2S |
| Molecular Weight | 428.56 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione |
| SMILES | COc1cc(O)cc(Cn2c3c(c4ccccc42)CCN(Cc2ccccc2)C3=S)c1 |
| InChI | InChI=1S/C26H24N2O2S/c1-30-21-14-19(13-20(29)15-21)17-28-24-10-6-5-9-22(24)23-11-12-27(26(31)25(23)28)16-18-7-3-2-4-8-18/h2-10,13-15,29H,11-12,16-17H2,1H3 |
| InChIKey | IVOQLYVNKIOGJS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.56 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione?
The IUPAC name of 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione (CID 127043741) is 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione.
What is the SMILES notation for 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione?
The canonical SMILES for 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione is COc1cc(O)cc(Cn2c3c(c4ccccc42)CCN(Cc2ccccc2)C3=S)c1.
What is the InChIKey of 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione?
The InChIKey is IVOQLYVNKIOGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2O2S/c1-30-21-14-19(13-20(29)15-21)17-28-24-10-6-5-9-22(24)23-11-12-27(26(31)25(23)28)16-18-7-3-2-4-8-18/h2-10,13-15,29H,11-12,16-17H2,1H3.
What are the key properties of 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione?
2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione has a molecular weight of 428.56 g/mol, XLogP of 5.14, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-9-[(3-hydroxy-5-methoxyphenyl)methyl]-3,4-dihydropyrido[3,4-b]indole-1-thione is sourced from PubChem (CID 127043741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).