C21H23NO — CID 127043824
(1S,3S)-1-(3,5-dimethylphenyl)-3,10-dimethyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole (PubChem CID 127043824) has the molecular formula C21H23NO and a molecular weight of 305.42 g/mol. Its IUPAC name is (1S,3S)-1-(3,5-dimethylphenyl)-3,10-dimethyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole.
| Compound Name | (1S,3S)-1-(3,5-dimethylphenyl)-3,10-dimethyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole |
|---|---|
| PubChem CID | 127043824 |
| Molecular Formula | C21H23NO |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | (1S,3S)-1-(3,5-dimethylphenyl)-3,10-dimethyl-3,4-dihydro-1H-[1,4]oxazino[4,3-a]indole |
| SMILES | Cc1cc(C)cc([C@@H]2O[C@@H](C)Cn3c2c(C)c2ccccc23)c1 |
| InChI | InChI=1S/C21H23NO/c1-13-9-14(2)11-17(10-13)21-20-16(4)18-7-5-6-8-19(18)22(20)12-15(3)23-21/h5-11,15,21H,12H2,1-4H3/t15-,21-/m0/s1 |
| InChIKey | ALPBRABBJPQXJW-BTYIYWSLSA-N |
| XLogP | 5.07 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |