C18H20F2O3 — CID 127044093
2-[3-(2,5-difluorophenyl)propyl]-1,3,5-trimethoxybenzene (PubChem CID 127044093) has the molecular formula C18H20F2O3 and a molecular weight of 322.35 g/mol. Its IUPAC name is 2-[3-(2,5-difluorophenyl)propyl]-1,3,5-trimethoxybenzene.
| Compound Name | 2-[3-(2,5-difluorophenyl)propyl]-1,3,5-trimethoxybenzene |
|---|---|
| PubChem CID | 127044093 |
| Molecular Formula | C18H20F2O3 |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 2-[3-(2,5-difluorophenyl)propyl]-1,3,5-trimethoxybenzene |
| SMILES | COc1cc(OC)c(CCCc2cc(F)ccc2F)c(OC)c1 |
| InChI | InChI=1S/C18H20F2O3/c1-21-14-10-17(22-2)15(18(11-14)23-3)6-4-5-12-9-13(19)7-8-16(12)20/h7-11H,4-6H2,1-3H3 |
| InChIKey | OKNRMXLIUYVINE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |