About N-(3,4-difluorophenyl)-2,4,6-trimethylaniline
N-(3,4-difluorophenyl)-2,4,6-trimethylaniline (PubChem CID 127044218) has the molecular formula C15H15F2N
and a molecular weight of 247.29 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-2,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N-(3,4-difluorophenyl)-2,4,6-trimethylaniline |
| PubChem CID | 127044218 |
| Molecular Formula | C15H15F2N |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-(3,4-difluorophenyl)-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(Nc2ccc(F)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C15H15F2N/c1-9-6-10(2)15(11(3)7-9)18-12-4-5-13(16)14(17)8-12/h4-8,18H,1-3H3 |
| InChIKey | KHTIKBLGKGMBMT-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-(3,4-difluorophenyl)-2,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,4-difluorophenyl)-2,4,6-trimethylaniline?
The IUPAC name of N-(3,4-difluorophenyl)-2,4,6-trimethylaniline (CID 127044218) is N-(3,4-difluorophenyl)-2,4,6-trimethylaniline.
What is the SMILES notation for N-(3,4-difluorophenyl)-2,4,6-trimethylaniline?
The canonical SMILES for N-(3,4-difluorophenyl)-2,4,6-trimethylaniline is Cc1cc(C)c(Nc2ccc(F)c(F)c2)c(C)c1.
What is the InChIKey of N-(3,4-difluorophenyl)-2,4,6-trimethylaniline?
The InChIKey is KHTIKBLGKGMBMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15F2N/c1-9-6-10(2)15(11(3)7-9)18-12-4-5-13(16)14(17)8-12/h4-8,18H,1-3H3.
What are the key properties of N-(3,4-difluorophenyl)-2,4,6-trimethylaniline?
N-(3,4-difluorophenyl)-2,4,6-trimethylaniline has a molecular weight of 247.29 g/mol, XLogP of 4.63, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,4-difluorophenyl)-2,4,6-trimethylaniline is sourced from PubChem (CID 127044218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).