C22H21N3O3 — CID 127044239
6-(3-morpholin-4-ylpropyl)indeno[2,1-f][1,7]naphthyridine-5,11-dione (PubChem CID 127044239) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 6-(3-morpholin-4-ylpropyl)indeno[2,1-f][1,7]naphthyridine-5,11-dione.
| Compound Name | 6-(3-morpholin-4-ylpropyl)indeno[2,1-f][1,7]naphthyridine-5,11-dione |
|---|---|
| PubChem CID | 127044239 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 6-(3-morpholin-4-ylpropyl)indeno[2,1-f][1,7]naphthyridine-5,11-dione |
| SMILES | O=C1c2ccccc2-c2c1c1cccnc1c(=O)n2CCCN1CCOCC1 |
| InChI | InChI=1S/C22H21N3O3/c26-21-16-6-2-1-5-15(16)20-18(21)17-7-3-8-23-19(17)22(27)25(20)10-4-9-24-11-13-28-14-12-24/h1-3,5-8H,4,9-14H2 |
| InChIKey | HICQBKOKORWOBE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|