About trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol
trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol (PubChem CID 127044467) has the molecular formula C17H16F3NO
and a molecular weight of 307.32 g/mol. Its IUPAC name is trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol |
| PubChem CID | 127044467 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol |
| SMILES | O[C@]1(c2ccccn2)CC[C@H](c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C17H16F3NO/c18-17(19,20)14-6-4-12(5-7-14)13-8-9-16(22,11-13)15-3-1-2-10-21-15/h1-7,10,13,22H,8-9,11H2/t13-,16+/m0/s1 |
| InChIKey | SWUXARATNCEGDV-XJKSGUPXSA-N |
| XLogP | 4.26 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol?
The IUPAC name of trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol (CID 127044467) is trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol.
What is the SMILES notation for trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol?
The canonical SMILES for trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol is O[C@]1(c2ccccn2)CC[C@H](c2ccc(C(F)(F)F)cc2)C1.
What is the InChIKey of trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol?
The InChIKey is SWUXARATNCEGDV-XJKSGUPXSA-N. The full InChI is InChI=1S/C17H16F3NO/c18-17(19,20)14-6-4-12(5-7-14)13-8-9-16(22,11-13)15-3-1-2-10-21-15/h1-7,10,13,22H,8-9,11H2/t13-,16+/m0/s1.
What are the key properties of trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol?
trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol has a molecular weight of 307.32 g/mol, XLogP of 4.26, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1R,3S)-1-pyridin-2-yl-3-[4-(trifluoromethyl)phenyl]cyclopentan-1-ol is sourced from PubChem (CID 127044467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).