C16H20N4O3 — CID 127044506
1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-2-(4-methylpiperazin-1-yl)ethanone (PubChem CID 127044506) has the molecular formula C16H20N4O3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-2-(4-methylpiperazin-1-yl)ethanone.
| Compound Name | 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-2-(4-methylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 127044506 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 1-(3-methyl-4-oxido-1-oxoquinoxalin-1-ium-2-yl)-2-(4-methylpiperazin-1-yl)ethanone |
| SMILES | Cc1c(C(=O)CN2CCN(C)CC2)[n+](=O)c2ccccc2n1[O-] |
| InChI | InChI=1S/C16H20N4O3/c1-12-16(15(21)11-18-9-7-17(2)8-10-18)20(23)14-6-4-3-5-13(14)19(12)22/h3-6H,7-11H2,1-2H3 |
| InChIKey | UHIQFDFBICHPAM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 74.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|