C24H30ClN — CID 127044646
(2E,4E)-N-methyl-5-phenyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)penta-2,4-dien-1-amine;hydrochloride (PubChem CID 127044646) has the molecular formula C24H30ClN and a molecular weight of 367.96 g/mol. Its IUPAC name is (2E,4E)-N-methyl-5-phenyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)penta-2,4-dien-1-amine;hydrochloride.
| Compound Name | (2E,4E)-N-methyl-5-phenyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)penta-2,4-dien-1-amine;hydrochloride |
|---|---|
| PubChem CID | 127044646 |
| Molecular Formula | C24H30ClN |
| Molecular Weight | 367.96 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | (2E,4E)-N-methyl-5-phenyl-N-(6,7,8,9-tetrahydro-5H-benzo[7]annulen-3-ylmethyl)penta-2,4-dien-1-amine;hydrochloride |
| SMILES | CN(C/C=C/C=C/c1ccccc1)Cc1ccc2c(c1)CCCCC2.Cl |
| InChI | InChI=1S/C24H29N.ClH/c1-25(18-10-4-7-13-21-11-5-2-6-12-21)20-22-16-17-23-14-8-3-9-15-24(23)19-22;/h2,4-7,10-13,16-17,19H,3,8-9,14-15,18,20H2,1H3;1H/b10-4+,13-7+; |
| InChIKey | HWSXGIJQOQFYBV-DENHNWLZSA-N |
| XLogP | 6.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.96 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|