C32H34N6O7 — CID 127044682
2-[4-[3-[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]phenyl]triazol-1-yl]acetic acid (PubChem CID 127044682) has the molecular formula C32H34N6O7 and a molecular weight of 614.66 g/mol. Its IUPAC name is 2-[4-[3-[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]phenyl]triazol-1-yl]acetic acid.
| Compound Name | 2-[4-[3-[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]phenyl]triazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 127044682 |
| Molecular Formula | C32H34N6O7 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.25 |
| IUPAC Name | 2-[4-[3-[[(2S)-2,6-bis(phenylmethoxycarbonylamino)hexanoyl]amino]phenyl]triazol-1-yl]acetic acid |
| SMILES | O=C(O)Cn1cc(-c2cccc(NC(=O)[C@H](CCCCNC(=O)OCc3ccccc3)NC(=O)OCc3ccccc3)c2)nn1 |
| InChI | InChI=1S/C32H34N6O7/c39-29(40)20-38-19-28(36-37-38)25-14-9-15-26(18-25)34-30(41)27(35-32(43)45-22-24-12-5-2-6-13-24)16-7-8-17-33-31(42)44-21-23-10-3-1-4-11-23/h1-6,9-15,18-19,27H,7-8,16-17,20-22H2,(H,33,42)(H,34,41)(H,35,43)(H,39,40)/t27-/m0/s1 |
| InChIKey | NNOKLCIVZHAEGS-MHZLTWQESA-N |
| XLogP | 4.36 |
| TPSA | 173.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|