C13H16O6S — CID 127044837
[(3aR,4R,6aS)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate (PubChem CID 127044837) has the molecular formula C13H16O6S and a molecular weight of 300.33 g/mol. Its IUPAC name is [(3aR,4R,6aS)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(3aR,4R,6aS)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 127044837 |
| Molecular Formula | C13H16O6S |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | [(3aR,4R,6aS)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC[C@@H]3OCO[C@@H]32)cc1 |
| InChI | InChI=1S/C13H16O6S/c1-9-2-4-10(5-3-9)20(14,15)19-7-12-13-11(6-16-12)17-8-18-13/h2-5,11-13H,6-8H2,1H3/t11-,12+,13-/m0/s1 |
| InChIKey | FHLYURXHPJPXBB-XQQFMLRXSA-N |
| XLogP | 0.84 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|