C30H33F4N5O4 — CID 127045013
[(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 127045013) has the molecular formula C30H33F4N5O4 and a molecular weight of 603.62 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 127045013 |
| Molecular Formula | C30H33F4N5O4 |
| Molecular Weight | 603.62 g/mol |
| Exact Mass | 603.25 |
| IUPAC Name | [(3S,6R)-6-[2-[3-[[(2S)-2-amino-3,3-diphenylpropanoyl]amino]-5-fluoro-4-pyridinyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | N[C@H](C(=O)Nc1cncc(F)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H33F4N5O4/c31-24-14-36-15-25(39-28(40)27(35)26(19-7-3-1-4-8-19)20-9-5-2-6-10-20)23(24)12-11-22-13-37-21(16-42-22)17-43-29(41)38-18-30(32,33)34/h1-10,14-15,21-22,26-27,37H,11-13,16-18,35H2,(H,38,41)(H,39,40)/t21-,22+,27-/m0/s1 |
| InChIKey | XEJRKVCKRPQXCJ-XXAUWVGASA-N |
| XLogP | 3.90 |
| TPSA | 127.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.62 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |