About 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide
4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide (PubChem CID 127045037) has the molecular formula C14H18N4O2S2
and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| PubChem CID | 127045037 |
| Molecular Formula | C14H18N4O2S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Nc2nc(N3CCCCC3)cs2)cc1 |
| InChI | InChI=1S/C14H18N4O2S2/c15-22(19,20)12-6-4-11(5-7-12)16-14-17-13(10-21-14)18-8-2-1-3-9-18/h4-7,10H,1-3,8-9H2,(H,16,17)(H2,15,19,20) |
| InChIKey | IXYXFANXVSIQKW-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
The IUPAC name of 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide (CID 127045037) is 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide.
What is the SMILES notation for 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
The canonical SMILES for 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide is NS(=O)(=O)c1ccc(Nc2nc(N3CCCCC3)cs2)cc1.
What is the InChIKey of 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
The InChIKey is IXYXFANXVSIQKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S2/c15-22(19,20)12-6-4-11(5-7-12)16-14-17-13(10-21-14)18-8-2-1-3-9-18/h4-7,10H,1-3,8-9H2,(H,16,17)(H2,15,19,20).
What are the key properties of 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide?
4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide has a molecular weight of 338.46 g/mol, XLogP of 2.52, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-piperidin-1-yl-1,3-thiazol-2-yl)amino]benzenesulfonamide is sourced from PubChem (CID 127045037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).