About 6-chloro-7-fluoroquinoxaline-2,3-diamine
6-chloro-7-fluoroquinoxaline-2,3-diamine (PubChem CID 127045068) has the molecular formula C8H6ClFN4
and a molecular weight of 212.62 g/mol. Its IUPAC name is 6-chloro-7-fluoroquinoxaline-2,3-diamine.
Molecular Properties
| Compound Name | 6-chloro-7-fluoroquinoxaline-2,3-diamine |
| PubChem CID | 127045068 |
| Molecular Formula | C8H6ClFN4 |
| Molecular Weight | 212.62 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 6-chloro-7-fluoroquinoxaline-2,3-diamine |
| SMILES | Nc1nc2cc(F)c(Cl)cc2nc1N |
| InChI | InChI=1S/C8H6ClFN4/c9-3-1-5-6(2-4(3)10)14-8(12)7(11)13-5/h1-2H,(H2,11,13)(H2,12,14) |
| InChIKey | FWUKLFMFGLUXCC-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.62 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-7-fluoroquinoxaline-2,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-7-fluoroquinoxaline-2,3-diamine?
The IUPAC name of 6-chloro-7-fluoroquinoxaline-2,3-diamine (CID 127045068) is 6-chloro-7-fluoroquinoxaline-2,3-diamine.
What is the SMILES notation for 6-chloro-7-fluoroquinoxaline-2,3-diamine?
The canonical SMILES for 6-chloro-7-fluoroquinoxaline-2,3-diamine is Nc1nc2cc(F)c(Cl)cc2nc1N.
What is the InChIKey of 6-chloro-7-fluoroquinoxaline-2,3-diamine?
The InChIKey is FWUKLFMFGLUXCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6ClFN4/c9-3-1-5-6(2-4(3)10)14-8(12)7(11)13-5/h1-2H,(H2,11,13)(H2,12,14).
What are the key properties of 6-chloro-7-fluoroquinoxaline-2,3-diamine?
6-chloro-7-fluoroquinoxaline-2,3-diamine has a molecular weight of 212.62 g/mol, XLogP of 1.59, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-7-fluoroquinoxaline-2,3-diamine is sourced from PubChem (CID 127045068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).