C38H36FN5O2 — CID 127045094
N-[6-[2-[2-[2-amino-3-[3-(3,3-dimethylbutylamino)-3-oxopropyl]quinolin-6-yl]phenyl]ethynyl]-3-pyridinyl]-4-fluorobenzamide (PubChem CID 127045094) has the molecular formula C38H36FN5O2 and a molecular weight of 613.74 g/mol. Its IUPAC name is N-[6-[2-[2-[2-amino-3-[3-(3,3-dimethylbutylamino)-3-oxopropyl]quinolin-6-yl]phenyl]ethynyl]-3-pyridinyl]-4-fluorobenzamide.
| Compound Name | N-[6-[2-[2-[2-amino-3-[3-(3,3-dimethylbutylamino)-3-oxopropyl]quinolin-6-yl]phenyl]ethynyl]-3-pyridinyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 127045094 |
| Molecular Formula | C38H36FN5O2 |
| Molecular Weight | 613.74 g/mol |
| Exact Mass | 613.29 |
| IUPAC Name | N-[6-[2-[2-[2-amino-3-[3-(3,3-dimethylbutylamino)-3-oxopropyl]quinolin-6-yl]phenyl]ethynyl]-3-pyridinyl]-4-fluorobenzamide |
| SMILES | CC(C)(C)CCNC(=O)CCc1cc2cc(-c3ccccc3C#Cc3ccc(NC(=O)c4ccc(F)cc4)cn3)ccc2nc1N |
| InChI | InChI=1S/C38H36FN5O2/c1-38(2,3)20-21-41-35(45)19-12-28-23-29-22-27(11-18-34(29)44-36(28)40)33-7-5-4-6-25(33)10-15-31-16-17-32(24-42-31)43-37(46)26-8-13-30(39)14-9-26/h4-9,11,13-14,16-18,22-24H,12,19-21H2,1-3H3,(H2,40,44)(H,41,45)(H,43,46) |
| InChIKey | LXBIVXKQYPZTSX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.74 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|