C21H17F6N3O2S — CID 127045171
4-[3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide (PubChem CID 127045171) has the molecular formula C21H17F6N3O2S and a molecular weight of 489.44 g/mol. Its IUPAC name is 4-[3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide.
| Compound Name | 4-[3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 127045171 |
| Molecular Formula | C21H17F6N3O2S |
| Molecular Weight | 489.44 g/mol |
| Exact Mass | 489.09 |
| IUPAC Name | 4-[3-[3,5-bis(trifluoromethyl)phenyl]-5,5-dimethyl-4-oxo-2-sulfanylideneimidazolidin-1-yl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(N2C(=S)N(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)C(=O)C2(C)C)cc1 |
| InChI | InChI=1S/C21H17F6N3O2S/c1-19(2)17(32)29(15-9-12(20(22,23)24)8-13(10-15)21(25,26)27)18(33)30(19)14-6-4-11(5-7-14)16(31)28-3/h4-10H,1-3H3,(H,28,31) |
| InChIKey | VRYINRVCPGQZAZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|