C28H26N2O5 — CID 127045273
6-[4-[2-(diethylamino)ethoxy]phenyl]-3,9-dihydroxyindeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127045273) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is 6-[4-[2-(diethylamino)ethoxy]phenyl]-3,9-dihydroxyindeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 6-[4-[2-(diethylamino)ethoxy]phenyl]-3,9-dihydroxyindeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127045273 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | 6-[4-[2-(diethylamino)ethoxy]phenyl]-3,9-dihydroxyindeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | CCN(CC)CCOc1ccc(-n2c3c(c4ccc(O)cc4c2=O)C(=O)c2cc(O)ccc2-3)cc1 |
| InChI | InChI=1S/C28H26N2O5/c1-3-29(4-2)13-14-35-20-9-5-17(6-10-20)30-26-22-12-8-18(31)15-23(22)27(33)25(26)21-11-7-19(32)16-24(21)28(30)34/h5-12,15-16,31-32H,3-4,13-14H2,1-2H3 |
| InChIKey | SHHHKAVMEUEQFF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'} |
|---|