C16H18ClN — CID 127045412
N-(3-chloro-4-methylphenyl)-2,4,6-trimethylaniline (PubChem CID 127045412) has the molecular formula C16H18ClN and a molecular weight of 259.78 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-2,4,6-trimethylaniline.
| Compound Name | N-(3-chloro-4-methylphenyl)-2,4,6-trimethylaniline |
|---|---|
| PubChem CID | 127045412 |
| Molecular Formula | C16H18ClN |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-2,4,6-trimethylaniline |
| SMILES | Cc1cc(C)c(Nc2ccc(C)c(Cl)c2)c(C)c1 |
| InChI | InChI=1S/C16H18ClN/c1-10-7-12(3)16(13(4)8-10)18-14-6-5-11(2)15(17)9-14/h5-9,18H,1-4H3 |
| InChIKey | QNDLVRFBVGHBEE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |