C23H30N6S — CID 127045443
2-[4-[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]-1,1,3,3-tetramethylguanidine (PubChem CID 127045443) has the molecular formula C23H30N6S and a molecular weight of 422.60 g/mol. Its IUPAC name is 2-[4-[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]-1,1,3,3-tetramethylguanidine.
| Compound Name | 2-[4-[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]-1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 127045443 |
| Molecular Formula | C23H30N6S |
| Molecular Weight | 422.60 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | 2-[4-[2-(4-butylphenyl)-4-methyl-1,3-thiazol-5-yl]pyrimidin-2-yl]-1,1,3,3-tetramethylguanidine |
| SMILES | CCCCc1ccc(-c2nc(C)c(-c3ccnc(N=C(N(C)C)N(C)C)n3)s2)cc1 |
| InChI | InChI=1S/C23H30N6S/c1-7-8-9-17-10-12-18(13-11-17)21-25-16(2)20(30-21)19-14-15-24-22(26-19)27-23(28(3)4)29(5)6/h10-15H,7-9H2,1-6H3 |
| InChIKey | JVTADDSVCZHGNJ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.60 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|