C31H30N2O5 — CID 127045578
3,9-dimethoxy-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indeno[1,2-c]isoquinoline-5,11-dione (PubChem CID 127045578) has the molecular formula C31H30N2O5 and a molecular weight of 510.59 g/mol. Its IUPAC name is 3,9-dimethoxy-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indeno[1,2-c]isoquinoline-5,11-dione.
| Compound Name | 3,9-dimethoxy-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indeno[1,2-c]isoquinoline-5,11-dione |
|---|---|
| PubChem CID | 127045578 |
| Molecular Formula | C31H30N2O5 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.22 |
| IUPAC Name | 3,9-dimethoxy-6-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]indeno[1,2-c]isoquinoline-5,11-dione |
| SMILES | COc1ccc2c(c1)C(=O)c1c-2n(-c2ccc(OCCCN3CCCC3)cc2)c(=O)c2cc(OC)ccc12 |
| InChI | InChI=1S/C31H30N2O5/c1-36-22-11-13-25-26(18-22)30(34)28-24-12-10-23(37-2)19-27(24)31(35)33(29(25)28)20-6-8-21(9-7-20)38-17-5-16-32-14-3-4-15-32/h6-13,18-19H,3-5,14-17H2,1-2H3 |
| InChIKey | KJPGKQRIVKZTSQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_phenone_A(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|